Source code for pymc.step_methods.metropolis

#   Copyright 2020 The PyMC Developers
#   Licensed under the Apache License, Version 2.0 (the "License");
#   you may not use this file except in compliance with the License.
#   You may obtain a copy of the License at
#   Unless required by applicable law or agreed to in writing, software
#   distributed under the License is distributed on an "AS IS" BASIS,
#   WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
#   See the License for the specific language governing permissions and
#   limitations under the License.
from typing import Callable, Dict, List, Optional, Tuple

import numpy as np
import numpy.random as nr
import pytensor
import scipy.linalg
import scipy.special

from pytensor import tensor as at
from pytensor.graph.fg import MissingInputError
from pytensor.tensor.random.basic import BernoulliRV, CategoricalRV

import pymc as pm

from pymc.blocking import DictToArrayBijection, RaveledVars
from pymc.pytensorf import (
from pymc.step_methods.arraystep import (

__all__ = [

from pymc.util import get_value_vars_from_user_vars

# Available proposal distributions for Metropolis

class Proposal:
    def __init__(self, s):
        self.s = s

[docs]class NormalProposal(Proposal): def __call__(self, rng: Optional[np.random.Generator] = None): return (rng or nr).normal(scale=self.s)
[docs]class UniformProposal(Proposal): def __call__(self, rng: Optional[np.random.Generator] = None): return (rng or nr).uniform(low=-self.s, high=self.s, size=len(self.s))
[docs]class CauchyProposal(Proposal): def __call__(self, rng: Optional[np.random.Generator] = None): return (rng or nr).standard_cauchy(size=np.size(self.s)) * self.s
[docs]class LaplaceProposal(Proposal): def __call__(self, rng: Optional[np.random.Generator] = None): size = np.size(self.s) r = rng or nr return (r.standard_exponential(size=size) - r.standard_exponential(size=size)) * self.s
[docs]class PoissonProposal(Proposal): def __call__(self, rng: Optional[np.random.Generator] = None): return (rng or nr).poisson(lam=self.s, size=np.size(self.s)) - self.s
[docs]class MultivariateNormalProposal(Proposal):
[docs] def __init__(self, s): n, m = s.shape if n != m: raise ValueError("Covariance matrix is not symmetric.") self.n = n self.chol = scipy.linalg.cholesky(s, lower=True)
def __call__(self, num_draws=None, rng: Optional[np.random.Generator] = None): rng_ = rng or nr if num_draws is not None: b = rng_.normal(size=(self.n, num_draws)) return, b).T else: b = rng_.normal(size=self.n) return, b)
[docs]class Metropolis(ArrayStepShared): """Metropolis-Hastings sampling step""" name = "metropolis" default_blocked = False stats_dtypes = [ { "accept": np.float64, "accepted": np.float64, "tune": bool, "scaling": np.float64, } ]
[docs] def __init__( self, vars=None, S=None, proposal_dist=None, scaling=1.0, tune=True, tune_interval=100, model=None, mode=None, **kwargs ): """Create an instance of a Metropolis stepper Parameters ---------- vars: list List of value variables for sampler S: standard deviation or covariance matrix Some measure of variance to parameterize proposal distribution proposal_dist: function Function that returns zero-mean deviates when parameterized with S (and n). Defaults to normal. scaling: scalar or array Initial scale factor for proposal. Defaults to 1. tune: bool Flag for tuning. Defaults to True. tune_interval: int The frequency of tuning. Defaults to 100 iterations. model: PyMC Model Optional model for sampling step. Defaults to None (taken from context). mode: string or `Mode` instance. compilation mode passed to PyTensor functions """ model = pm.modelcontext(model) initial_values = model.initial_point() if vars is None: vars = model.value_vars else: vars = get_value_vars_from_user_vars(vars, model) initial_values_shape = [initial_values[].shape for v in vars] if S is None: S = np.ones(int(sum( for ivs in initial_values_shape))) if proposal_dist is not None: self.proposal_dist = proposal_dist(S) elif S.ndim == 1: self.proposal_dist = NormalProposal(S) elif S.ndim == 2: self.proposal_dist = MultivariateNormalProposal(S) else: raise ValueError("Invalid rank for variance: %s" % S.ndim) self.scaling = np.atleast_1d(scaling).astype("d") self.tune = tune self.tune_interval = tune_interval self.steps_until_tune = tune_interval # Determine type of variables self.discrete = np.concatenate( [[v.dtype in pm.discrete_types] * (initial_values[].size or 1) for v in vars] ) self.any_discrete = self.discrete.any() self.all_discrete = self.discrete.all() # Metropolis will try to handle one batched dimension at a time This, however, # is not safe for discrete multivariate distributions (looking at you Multinomial), # due to high dependency among the support dimensions. For continuous multivariate # distributions we assume they are being transformed in a way that makes each # dimension semi-independent. is_scalar = len(initial_values_shape) == 1 and initial_values_shape[0] == () self.elemwise_update = not ( is_scalar or ( self.any_discrete and max(getattr(model.values_to_rvs[var].owner.op, "ndim_supp", 1) for var in vars) > 0 ) ) if self.elemwise_update: dims = int(sum( for ivs in initial_values_shape)) else: dims = 1 self.enum_dims = np.arange(dims, dtype=int) self.accept_rate_iter = np.zeros(dims, dtype=float) self.accepted_iter = np.zeros(dims, dtype=bool) self.accepted_sum = np.zeros(dims, dtype=int) # remember initial settings before tuning so they can be reset self._untuned_settings = dict(scaling=self.scaling, steps_until_tune=tune_interval) # TODO: This is not being used when compiling the logp function! self.mode = mode shared = pm.make_shared_replacements(initial_values, vars, model) self.delta_logp = delta_logp(initial_values, model.logp(), vars, shared) super().__init__(vars, shared)
[docs] def reset_tuning(self): """Resets the tuned sampler parameters to their initial values.""" for attr, initial_value in self._untuned_settings.items(): setattr(self, attr, initial_value) self.accepted_sum[:] = 0 return
[docs] def astep(self, q0: RaveledVars) -> Tuple[RaveledVars, StatsType]: point_map_info = q0.point_map_info q0d = if not self.steps_until_tune and self.tune: # Tune scaling parameter self.scaling = tune(self.scaling, self.accepted_sum / float(self.tune_interval)) # Reset counter self.steps_until_tune = self.tune_interval self.accepted_sum[:] = 0 delta = self.proposal_dist() * self.scaling if self.any_discrete: if self.all_discrete: delta = np.round(delta, 0).astype("int64") q0d = q0d.astype("int64") q = (q0d + delta).astype("int64") else: delta[self.discrete] = np.round(delta[self.discrete], 0) q = q0d + delta else: q = floatX(q0d + delta) if self.elemwise_update: q_temp = q0d.copy() # Shuffle order of updates (probably we don't need to do this in every step) np.random.shuffle(self.enum_dims) for i in self.enum_dims: q_temp[i] = q[i] accept_rate_i = self.delta_logp(q_temp, q0d) q_temp_, accepted_i = metrop_select(accept_rate_i, q_temp, q0d) q_temp[i] = q_temp_[i] self.accept_rate_iter[i] = accept_rate_i self.accepted_iter[i] = accepted_i self.accepted_sum[i] += accepted_i q = q_temp else: accept_rate = self.delta_logp(q, q0d) q, accepted = metrop_select(accept_rate, q, q0d) self.accept_rate_iter = accept_rate self.accepted_iter = accepted self.accepted_sum += accepted self.steps_until_tune -= 1 stats = { "tune": self.tune, "scaling": np.mean(self.scaling), "accept": np.mean(np.exp(self.accept_rate_iter)), "accepted": np.mean(self.accepted_iter), } return RaveledVars(q, point_map_info), [stats]
[docs] @staticmethod def competence(var, has_grad): return Competence.COMPATIBLE
def tune(scale, acc_rate): """ Tunes the scaling parameter for the proposal distribution according to the acceptance rate over the last tune_interval: Rate Variance adaptation ---- ------------------- <0.001 x 0.1 <0.05 x 0.5 <0.2 x 0.9 >0.5 x 1.1 >0.75 x 2 >0.95 x 10 """ return scale * np.where( acc_rate < 0.001, # reduce by 90 percent 0.1, np.where( acc_rate < 0.05, # reduce by 50 percent 0.5, np.where( acc_rate < 0.2, # reduce by ten percent 0.9, np.where( acc_rate > 0.95, # increase by factor of ten 10.0, np.where( acc_rate > 0.75, # increase by double 2.0, np.where( acc_rate > 0.5, # increase by ten percent 1.1, # Do not change 1.0, ), ), ), ), ), )
[docs]class BinaryMetropolis(ArrayStep): """Metropolis-Hastings optimized for binary variables Parameters ---------- vars: list List of value variables for sampler scaling: scalar or array Initial scale factor for proposal. Defaults to 1. tune: bool Flag for tuning. Defaults to True. tune_interval: int The frequency of tuning. Defaults to 100 iterations. model: PyMC Model Optional model for sampling step. Defaults to None (taken from context). """ name = "binary_metropolis" stats_dtypes = [ { "accept": np.float64, "tune": bool, "p_jump": np.float64, } ]
[docs] def __init__(self, vars, scaling=1.0, tune=True, tune_interval=100, model=None): model = pm.modelcontext(model) self.scaling = scaling self.tune = tune self.tune_interval = tune_interval self.steps_until_tune = tune_interval self.accepted = 0 vars = get_value_vars_from_user_vars(vars, model) if not all([v.dtype in pm.discrete_types for v in vars]): raise ValueError("All variables must be Bernoulli for BinaryMetropolis") super().__init__(vars, [model.compile_logp()])
[docs] def astep(self, apoint: RaveledVars, *args) -> Tuple[RaveledVars, StatsType]: logp = args[0] logp_q0 = logp(apoint) point_map_info = apoint.point_map_info q0 = # Convert adaptive_scale_factor to a jump probability p_jump = 1.0 - 0.5**self.scaling rand_array = nr.random(q0.shape) q = np.copy(q0) # Locations where switches occur, according to p_jump switch_locs = rand_array < p_jump q[switch_locs] = True - q[switch_locs] logp_q = logp(RaveledVars(q, point_map_info)) accept = logp_q - logp_q0 q_new, accepted = metrop_select(accept, q, q0) self.accepted += accepted stats = { "tune": self.tune, "accept": np.exp(accept), "p_jump": p_jump, } return RaveledVars(q_new, point_map_info), [stats]
[docs] @staticmethod def competence(var): """ BinaryMetropolis is only suitable for binary (bool) and Categorical variables with k=1. """ distribution = getattr(var.owner, "op", None) if isinstance(distribution, BernoulliRV): return Competence.COMPATIBLE if isinstance(distribution, CategoricalRV): # TODO: We could compute the initial value of `k` # if we had a model object. # k_graph = var.owner.inputs[3].shape[-1] # (k_graph,), _ = rvs_to_value_vars((k_graph,), apply_transforms=True) # k = model.fn(k_graph)(initial_point) try: k = var.owner.inputs[3].shape[-1].eval() if k == 2: return Competence.COMPATIBLE except MissingInputError: pass return Competence.INCOMPATIBLE
[docs]class BinaryGibbsMetropolis(ArrayStep): """A Metropolis-within-Gibbs step method optimized for binary variables Parameters ---------- vars: list List of value variables for sampler order: list or 'random' List of integers indicating the Gibbs update order e.g., [0, 2, 1, ...]. Default is random transit_p: float The diagonal of the transition kernel. A value > .5 gives anticorrelated proposals, which resulting in more efficient antithetical sampling. Default is 0.8 model: PyMC Model Optional model for sampling step. Defaults to None (taken from context). """ name = "binary_gibbs_metropolis"
[docs] def __init__(self, vars, order="random", transit_p=0.8, model=None): model = pm.modelcontext(model) # transition probabilities self.transit_p = transit_p vars = get_value_vars_from_user_vars(vars, model) initial_point = model.initial_point() self.dim = sum(initial_point[].size for v in vars) if order == "random": self.shuffle_dims = True self.order = list(range(self.dim)) else: if sorted(order) != list(range(self.dim)): raise ValueError("Argument 'order' has to be a permutation") self.shuffle_dims = False self.order = order if not all([v.dtype in pm.discrete_types for v in vars]): raise ValueError("All variables must be binary for BinaryGibbsMetropolis") super().__init__(vars, [model.compile_logp()])
[docs] def astep(self, apoint: RaveledVars, *args) -> Tuple[RaveledVars, StatsType]: logp: Callable[[RaveledVars], np.ndarray] = args[0] order = self.order if self.shuffle_dims: nr.shuffle(order) q = RaveledVars(np.copy(, apoint.point_map_info) logp_curr = logp(q) for idx in order: # No need to do metropolis update if the same value is proposed, # as you will get the same value regardless of accepted or reject if nr.rand() < self.transit_p: curr_val,[idx] =[idx], True -[idx] logp_prop = logp(q)[idx], accepted = metrop_select(logp_prop - logp_curr,[idx], curr_val) if accepted: logp_curr = logp_prop return q, []
[docs] @staticmethod def competence(var): """ BinaryMetropolis is only suitable for Bernoulli and Categorical variables with k=2. """ distribution = getattr(var.owner, "op", None) if isinstance(distribution, BernoulliRV): return Competence.IDEAL if isinstance(distribution, CategoricalRV): # TODO: We could compute the initial value of `k` # if we had a model object. # k_graph = var.owner.inputs[3].shape[-1] # (k_graph,), _ = rvs_to_value_vars((k_graph,), apply_transforms=True) # k = model.fn(k_graph)(initial_point) try: k = var.owner.inputs[3].shape[-1].eval() if k == 2: return Competence.IDEAL except MissingInputError: pass return Competence.INCOMPATIBLE
[docs]class CategoricalGibbsMetropolis(ArrayStep): """A Metropolis-within-Gibbs step method optimized for categorical variables. This step method works for Bernoulli variables as well, but it is not optimized for them, like BinaryGibbsMetropolis is. Step method supports two types of proposals: A uniform proposal and a proportional proposal, which was introduced by Liu in his 1996 technical report "Metropolized Gibbs Sampler: An Improvement". """ name = "categorical_gibbs_metropolis"
[docs] def __init__(self, vars, proposal="uniform", order="random", model=None): model = pm.modelcontext(model) vars = get_value_vars_from_user_vars(vars, model) initial_point = model.initial_point() dimcats = [] # The above variable is a list of pairs (aggregate dimension, number # of categories). For example, if vars = [x, y] with x being a 2-D # variable with M categories and y being a 3-D variable with N # categories, we will have dimcats = [(0, M), (1, M), (2, N), (3, N), (4, N)]. for v in vars: v_init_val = initial_point[] rv_var = model.values_to_rvs[v] distr = getattr(rv_var.owner, "op", None) if isinstance(distr, CategoricalRV): k_graph = rv_var.owner.inputs[3].shape[-1] (k_graph,) = model.replace_rvs_by_values((k_graph,)) k = model.compile_fn(k_graph, inputs=model.value_vars, on_unused_input="ignore")( initial_point ) elif isinstance(distr, BernoulliRV): k = 2 else: raise ValueError( "All variables must be categorical or binary" + "for CategoricalGibbsMetropolis" ) start = len(dimcats) dimcats += [(dim, k) for dim in range(start, start + v_init_val.size)] if order == "random": self.shuffle_dims = True self.dimcats = dimcats else: if sorted(order) != list(range(len(dimcats))): raise ValueError("Argument 'order' has to be a permutation") self.shuffle_dims = False self.dimcats = [dimcats[j] for j in order] if proposal == "uniform": self.astep = self.astep_unif elif proposal == "proportional": # Use the optimized "Metropolized Gibbs Sampler" described in Liu96. self.astep = self.astep_prop else: raise ValueError("Argument 'proposal' should either be 'uniform' or 'proportional'") super().__init__(vars, [model.compile_logp()])
[docs] def astep_unif(self, apoint: RaveledVars, *args) -> Tuple[RaveledVars, StatsType]: logp = args[0] point_map_info = apoint.point_map_info q0 = dimcats = self.dimcats if self.shuffle_dims: nr.shuffle(dimcats) q = RaveledVars(np.copy(q0), point_map_info) logp_curr = logp(q) for dim, k in dimcats: curr_val,[dim] =[dim], sample_except(k,[dim]) logp_prop = logp(q)[dim], accepted = metrop_select(logp_prop - logp_curr,[dim], curr_val) if accepted: logp_curr = logp_prop return q, []
[docs] def astep_prop(self, apoint: RaveledVars, *args) -> Tuple[RaveledVars, StatsType]: logp = args[0] point_map_info = apoint.point_map_info q0 = dimcats = self.dimcats if self.shuffle_dims: nr.shuffle(dimcats) q = RaveledVars(np.copy(q0), point_map_info) logp_curr = logp(q) for dim, k in dimcats: logp_curr = self.metropolis_proportional(q, logp, logp_curr, dim, k) return q, []
[docs] def astep(self, apoint: RaveledVars, *args) -> Tuple[RaveledVars, StatsType]: raise NotImplementedError()
[docs] def metropolis_proportional(self, q, logp, logp_curr, dim, k): given_cat = int([dim]) log_probs = np.zeros(k) log_probs[given_cat] = logp_curr candidates = list(range(k)) for candidate_cat in candidates: if candidate_cat != given_cat:[dim] = candidate_cat log_probs[candidate_cat] = logp(q) probs = scipy.special.softmax(log_probs, axis=0) prob_curr, probs[given_cat] = probs[given_cat], 0.0 probs /= 1.0 - prob_curr proposed_cat = nr.choice(candidates, p=probs) accept_ratio = (1.0 - prob_curr) / (1.0 - probs[proposed_cat]) if not np.isfinite(accept_ratio) or nr.uniform() >= accept_ratio:[dim] = given_cat return logp_curr[dim] = proposed_cat return log_probs[proposed_cat]
[docs] @staticmethod def competence(var): """ CategoricalGibbsMetropolis is only suitable for Bernoulli and Categorical variables. """ distribution = getattr(var.owner, "op", None) if isinstance(distribution, CategoricalRV): # TODO: We could compute the initial value of `k` # if we had a model object. # k_graph = var.owner.inputs[3].shape[-1] # (k_graph,), _ = rvs_to_value_vars((k_graph,), apply_transforms=True) # k = model.fn(k_graph)(initial_point) try: k = var.owner.inputs[3].shape[-1].eval() if k > 2: return Competence.IDEAL except MissingInputError: pass return Competence.COMPATIBLE if isinstance(distribution, BernoulliRV): return Competence.COMPATIBLE return Competence.INCOMPATIBLE
[docs]class DEMetropolis(PopulationArrayStepShared): """ Differential Evolution Metropolis sampling step. Parameters ---------- lamb: float Lambda parameter of the DE proposal mechanism. Defaults to 2.38 / sqrt(2 * ndim) vars: list List of variables for sampler S: standard deviation or covariance matrix Some measure of variance to parameterize proposal distribution proposal_dist: function Function that returns zero-mean deviates when parameterized with S (and n). Defaults to Uniform(-S,+S). scaling: scalar or array Initial scale factor for epsilon. Defaults to 0.001 tune: str Which hyperparameter to tune. Defaults to None, but can also be 'scaling' or 'lambda'. tune_interval: int The frequency of tuning. Defaults to 100 iterations. model: PyMC Model Optional model for sampling step. Defaults to None (taken from context). mode: string or `Mode` instance. compilation mode passed to PyTensor functions References ---------- .. [Braak2006] Cajo C.F. ter Braak (2006). A Markov Chain Monte Carlo version of the genetic algorithm Differential Evolution: easy Bayesian computing for real parameter spaces. Statistics and Computing `link <>`__ """ name = "DEMetropolis" default_blocked = True stats_dtypes = [ { "accept": np.float64, "accepted": bool, "tune": bool, "scaling": np.float64, "lambda": np.float64, } ]
[docs] def __init__( self, vars=None, S=None, proposal_dist=None, lamb=None, scaling=0.001, tune=None, tune_interval=100, model=None, mode=None, **kwargs ): model = pm.modelcontext(model) initial_values = model.initial_point() initial_values_size = sum(initial_values[].size for n in model.value_vars) if vars is None: vars = model.continuous_value_vars else: vars = get_value_vars_from_user_vars(vars, model) if S is None: S = np.ones(initial_values_size) if proposal_dist is not None: self.proposal_dist = proposal_dist(S) else: self.proposal_dist = UniformProposal(S) self.scaling = np.atleast_1d(scaling).astype("d") if lamb is None: # default to the optimal lambda for normally distributed targets lamb = 2.38 / np.sqrt(2 * initial_values_size) self.lamb = float(lamb) if tune not in {None, "scaling", "lambda"}: raise ValueError('The parameter "tune" must be one of {None, scaling, lambda}') self.tune = tune self.tune_interval = tune_interval self.steps_until_tune = tune_interval self.accepted = 0 self.mode = mode shared = pm.make_shared_replacements(initial_values, vars, model) self.delta_logp = delta_logp(initial_values, model.logp(), vars, shared) super().__init__(vars, shared)
[docs] def astep(self, q0: RaveledVars) -> Tuple[RaveledVars, StatsType]: point_map_info = q0.point_map_info q0d = if not self.steps_until_tune and self.tune: if self.tune == "scaling": self.scaling = tune(self.scaling, self.accepted / float(self.tune_interval)) elif self.tune == "lambda": self.lamb = tune(self.lamb, self.accepted / float(self.tune_interval)) # Reset counter self.steps_until_tune = self.tune_interval self.accepted = 0 epsilon = self.proposal_dist() * self.scaling # differential evolution proposal # select two other chains ir1, ir2 = np.random.choice(self.other_chains, 2, replace=False) r1 =[ir1]) r2 =[ir2]) # propose a jump q = floatX(q0d + self.lamb * ( - + epsilon) accept = self.delta_logp(q, q0d) q_new, accepted = metrop_select(accept, q, q0d) self.accepted += accepted self.steps_until_tune -= 1 stats = { "tune": self.tune, "scaling": self.scaling, "lambda": self.lamb, "accept": np.exp(accept), "accepted": accepted, } return RaveledVars(q_new, point_map_info), [stats]
[docs] @staticmethod def competence(var, has_grad): if var.dtype in pm.discrete_types: return Competence.INCOMPATIBLE return Competence.COMPATIBLE
[docs]class DEMetropolisZ(ArrayStepShared): """ Adaptive Differential Evolution Metropolis sampling step that uses the past to inform jumps. Parameters ---------- lamb: float Lambda parameter of the DE proposal mechanism. Defaults to 2.38 / sqrt(2 * ndim) vars: list List of variables for sampler S: standard deviation or covariance matrix Some measure of variance to parameterize proposal distribution proposal_dist: function Function that returns zero-mean deviates when parameterized with S (and n). Defaults to Uniform(-S,+S). scaling: scalar or array Initial scale factor for epsilon. Defaults to 0.001 tune: str Which hyperparameter to tune. Defaults to 'lambda', but can also be 'scaling' or None. tune_interval: int The frequency of tuning. Defaults to 100 iterations. tune_drop_fraction: float Fraction of tuning steps that will be removed from the samplers history when the tuning ends. Defaults to 0.9 - keeping the last 10% of tuning steps for good mixing while removing 90% of potentially unconverged tuning positions. model: PyMC Model Optional model for sampling step. Defaults to None (taken from context). mode: string or `Mode` instance. compilation mode passed to PyTensor functions References ---------- .. [Braak2006] Cajo C.F. ter Braak (2006). Differential Evolution Markov Chain with snooker updater and fewer chains. Statistics and Computing `link <>`__ """ name = "DEMetropolisZ" default_blocked = True stats_dtypes = [ { "accept": np.float64, "accepted": bool, "tune": bool, "scaling": np.float64, "lambda": np.float64, } ]
[docs] def __init__( self, vars=None, S=None, proposal_dist=None, lamb=None, scaling=0.001, tune="lambda", tune_interval=100, tune_drop_fraction: float = 0.9, model=None, mode=None, **kwargs ): model = pm.modelcontext(model) initial_values = model.initial_point() initial_values_size = sum(initial_values[].size for n in model.value_vars) if vars is None: vars = model.continuous_value_vars else: vars = get_value_vars_from_user_vars(vars, model) if S is None: S = np.ones(initial_values_size) if proposal_dist is not None: self.proposal_dist = proposal_dist(S) else: self.proposal_dist = UniformProposal(S) self.scaling = np.atleast_1d(scaling).astype("d") if lamb is None: # default to the optimal lambda for normally distributed targets lamb = 2.38 / np.sqrt(2 * initial_values_size) self.lamb = float(lamb) if tune not in {None, "scaling", "lambda"}: raise ValueError('The parameter "tune" must be one of {None, scaling, lambda}') self.tune = True self.tune_target = tune self.tune_interval = tune_interval self.tune_drop_fraction = tune_drop_fraction self.steps_until_tune = tune_interval self.accepted = 0 # cache local history for the Z-proposals self._history: List[np.ndarray] = [] # remember initial settings before tuning so they can be reset self._untuned_settings = dict( scaling=self.scaling, lamb=self.lamb, steps_until_tune=tune_interval, accepted=self.accepted, ) self.mode = mode shared = pm.make_shared_replacements(initial_values, vars, model) self.delta_logp = delta_logp(initial_values, model.logp(), vars, shared) super().__init__(vars, shared)
[docs] def reset_tuning(self): """Resets the tuned sampler parameters and history to their initial values.""" # history can't be reset via the _untuned_settings dict because it's a list self._history = [] for attr, initial_value in self._untuned_settings.items(): setattr(self, attr, initial_value) return
[docs] def astep(self, q0: RaveledVars) -> Tuple[RaveledVars, StatsType]: point_map_info = q0.point_map_info q0d = # same tuning scheme as DEMetropolis if not self.steps_until_tune and self.tune: if self.tune_target == "scaling": self.scaling = tune(self.scaling, self.accepted / float(self.tune_interval)) elif self.tune_target == "lambda": self.lamb = tune(self.lamb, self.accepted / float(self.tune_interval)) # Reset counter self.steps_until_tune = self.tune_interval self.accepted = 0 epsilon = self.proposal_dist() * self.scaling it = len(self._history) # use the DE-MCMC-Z proposal scheme as soon as the history has 2 entries if it > 1: # differential evolution proposal # select two other chains iz1 = np.random.randint(it) iz2 = np.random.randint(it) while iz2 == iz1: iz2 = np.random.randint(it) z1 = self._history[iz1] z2 = self._history[iz2] # propose a jump q = floatX(q0d + self.lamb * (z1 - z2) + epsilon) else: # propose just with noise in the first 2 iterations q = floatX(q0d + epsilon) accept = self.delta_logp(q, q0d) q_new, accepted = metrop_select(accept, q, q0d) self.accepted += accepted self._history.append(q_new) self.steps_until_tune -= 1 stats = { "tune": self.tune, "scaling": self.scaling, "lambda": self.lamb, "accept": np.exp(accept), "accepted": accepted, } return RaveledVars(q_new, point_map_info), [stats]
[docs] def stop_tuning(self): """At the end of the tuning phase, this method removes the first x% of the history so future proposals are not informed by unconverged tuning iterations. """ it = len(self._history) n_drop = int(self.tune_drop_fraction * it) self._history = self._history[n_drop:] return super().stop_tuning()
[docs] @staticmethod def competence(var, has_grad): if var.dtype in pm.discrete_types: return Competence.INCOMPATIBLE return Competence.COMPATIBLE
def sample_except(limit, excluded): candidate = nr.choice(limit - 1) if candidate >= excluded: candidate += 1 return candidate def delta_logp( point: Dict[str, np.ndarray], logp: at.TensorVariable, vars: List[at.TensorVariable], shared: Dict[at.TensorVariable, at.sharedvar.TensorSharedVariable], ) -> pytensor.compile.Function: [logp0], inarray0 = join_nonshared_inputs( point=point, outputs=[logp], inputs=vars, shared_inputs=shared ) tensor_type = inarray0.type inarray1 = tensor_type("inarray1") logp1 = CallableTensor(logp0)(inarray1) # Replace any potential duplicated RNG nodes (logp1,) = replace_rng_nodes((logp1,)) f = compile_pymc([inarray1, inarray0], logp1 - logp0) f.trust_input = True return f